4-Bromo-N-(4-methyl-1,3-thiazol-2-yl)benzamide structure
|
Common Name | 4-Bromo-N-(4-methyl-1,3-thiazol-2-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 302967-87-9 | Molecular Weight | 297.17100 | |
| Density | 1.619g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H9BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Bromo-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|
| Density | 1.619g/cm3 |
|---|---|
| Molecular Formula | C11H9BrN2OS |
| Molecular Weight | 297.17100 |
| Exact Mass | 295.96200 |
| PSA | 70.23000 |
| LogP | 3.53930 |
| Index of Refraction | 1.686 |
| InChIKey | YXUNUMNYOKSUJQ-UHFFFAOYSA-N |
| SMILES | Cc1csc(NC(=O)c2ccc(Br)cc2)n1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |