Phenazine, 2-chloro-,5,10-dioxide
Modify Date: 2026-07-03 17:17:46
Phenazine, 2-chloro-,5,10-dioxide structure
|
Common Name | Phenazine, 2-chloro-,5,10-dioxide | ||
|---|---|---|---|---|
| CAS Number | 303-79-7 | Molecular Weight | 246.64900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-10-oxidophenazin-5-ium 5-oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7ClN2O2 |
|---|---|
| Molecular Weight | 246.64900 |
| Exact Mass | 246.02000 |
| PSA | 50.92000 |
| LogP | 3.50340 |
| InChIKey | NFCIQNJPHBEHLU-UHFFFAOYSA-N |
| SMILES | O=[n+]1c2ccccc2n([O-])c2cc(Cl)ccc21 |
|
~%
Phenazine, 2-ch... CAS#:303-79-7 |
| Literature: Vivian Journal of the American Chemical Society, 1951 , vol. 73, p. 457 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:303-80-0
CAS#:4190-95-8|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 2-Chlorphenazin-5,10-dioxid |
| 2-Chlorophenazine 5,10-dioxide |
| Phenazine,2-chloro-,5,10-dioxide |
| 2-chlorophenazine 5,10-di-N-oxide |
| 2-Chlorphenazin-N,N'-dioxid |