3-bromo-6-(carboxymethylamino)-2-chlorobenzoic acid structure
|
Common Name | 3-bromo-6-(carboxymethylamino)-2-chlorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3030-10-2 | Molecular Weight | 308.51300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-6-(carboxymethylamino)-2-chlorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7BrClNO4 |
|---|---|
| Molecular Weight | 308.51300 |
| Exact Mass | 306.92500 |
| PSA | 77.84000 |
| LogP | 2.91490 |
| InChIKey | HBINZUACKOUUGV-UHFFFAOYSA-N |
| SMILES | O=C(O)CNc1ccc(Br)c(Cl)c1C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
3-bromo-6-(carb... CAS#:3030-10-2 |
| Literature: LATHAM, Keith, R. Patent: WO2013/10102 A2, 2013 ; Location in patent: Paragraph 00273 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-bromo-6-(carboxymethyl-amino)-2-chloro-benzoic acid |
| 3-Brom-6-(carboxymethyl-amino)-2-chlor-benzoesaeure |
| Benzoic acid,3-bromo-6-((carboxymethyl)amino)-2-chloro |
| 3-Chlor-4-brom-phenylglycin-carbonsaeure-(2) |