Ethanone,1,1'-(oxydi-4,1-phenylene)bis[2-chloro- structure
|
Common Name | Ethanone,1,1'-(oxydi-4,1-phenylene)bis[2-chloro- | ||
|---|---|---|---|---|
| CAS Number | 3030-53-3 | Molecular Weight | 323.17100 | |
| Density | 1.314 g/cm3 | Boiling Point | 481.2ºC at 760 mmHg | |
| Molecular Formula | C16H12Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192ºC | |
| Name | 2-chloro-1-[4-[4-(2-chloroacetyl)phenoxy]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314 g/cm3 |
|---|---|
| Boiling Point | 481.2ºC at 760 mmHg |
| Molecular Formula | C16H12Cl2O3 |
| Molecular Weight | 323.17100 |
| Flash Point | 192ºC |
| Exact Mass | 322.01600 |
| PSA | 43.37000 |
| LogP | 4.32190 |
| Index of Refraction | 1.585 |
| InChIKey | JVVSVPLSTGMSJT-UHFFFAOYSA-N |
| SMILES | O=C(CCl)c1ccc(Oc2ccc(C(=O)CCl)cc2)cc1 |
| HS Code | 2914700090 |
|---|
|
~69%
Ethanone,1,1'-(... CAS#:3030-53-3 |
| Literature: Ceylan, Yusuf; Usta, Ayhan; Usta, Keziban; Durmaz, Fatih; Coskun, Ahmet Journal of Molecular Structure, 2013 , vol. 1050, p. 69 - 72 |
|
~%
Ethanone,1,1'-(... CAS#:3030-53-3 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; BELEMA, Makonen; HEWAWASAM, Piyasena Patent: WO2012/39717 A1, 2012 ; Location in patent: Page/Page column 51-52 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Bis(4-chloroacetophenyl) ether |
| Bis-(4-chloracetyl-phenyl)-aether |
| Clofenoxydo |
| 4,4'-bis(chloroacetyl)diphenyl ether |
| Clofenoxyde |
| 1,1'-(4,4'-oxybis(4,1-phenylene))bis(2-chloroethanone) |
| 1,1'-(oxydi-4,1-phenylene)bis[2-chloroethanone] |
| Clofenoxydum |
| Stamycil |
| 4,4'-Oxybis(2-chloroacetophenone) |
| Bis(4-Chloroacetylphenyl)Ether |
| Clofenoxide |