2,2,8,8-tetramethylnonanedioic acid
Modify Date: 2025-10-15 20:11:16
2,2,8,8-tetramethylnonanedioic acid structure
|
Common Name | 2,2,8,8-tetramethylnonanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 30313-67-8 | Molecular Weight | 244.32700 | |
| Density | 1.051g/cm3 | Boiling Point | 391.3ºC at 760mmHg | |
| Molecular Formula | C13H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.6ºC | |
| Name | 2,2,8,8-tetramethylnonanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 391.3ºC at 760mmHg |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.32700 |
| Flash Point | 204.6ºC |
| Exact Mass | 244.16700 |
| PSA | 74.60000 |
| LogP | 3.15850 |
| Index of Refraction | 1.474 |
| InChIKey | UEZVTCSABYGOGY-UHFFFAOYSA-N |
| SMILES | CC(C)(CCCCCC(C)(C)C(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
2,2,8,8-tetrame... CAS#:30313-67-8 |
| Literature: Adams; Anderson Journal of the American Chemical Society, 1951 , vol. 73, p. 136,141 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Nonanedioic acid,2,2,8,8-tetramethyl |
| 2,2,8,8-Tetramethyl-nonandisaeure |
| 2,2,8,8-tetramethyl-nonanedioic acid |
| 2,2,8,8-Tetramethylazelainsaeure |