3-(2,5-Dimethylbenzoyl)butyric acid methyl ester structure
|
Common Name | 3-(2,5-Dimethylbenzoyl)butyric acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 30316-13-3 | Molecular Weight | 234.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-(2,5-dimethylphenyl)-3-methyl-4-oxobutanoate |
|---|
| Molecular Formula | C14H18O3 |
|---|---|
| Molecular Weight | 234.29100 |
| Exact Mass | 234.12600 |
| PSA | 43.37000 |
| LogP | 2.68530 |
| InChIKey | QEKOOPKDUCYYHF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C)C(=O)c1cc(C)ccc1C |
| HS Code | 2918300090 |
|---|
|
~%
3-(2,5-Dimethyl... CAS#:30316-13-3 |
| Literature: Eisenbraun,E.J. et al. Journal of Organic Chemistry, 1971 , vol. 36, # 17 p. 2480 - 2485 |
|
~%
3-(2,5-Dimethyl... CAS#:30316-13-3 |
| Literature: Eisenbraun,E.J. et al. Journal of Organic Chemistry, 1971 , vol. 36, # 17 p. 2480 - 2485 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |