trimethyl-(2-oxo-2-phenylmethoxyethyl)azanium,chloride structure
|
Common Name | trimethyl-(2-oxo-2-phenylmethoxyethyl)azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 3032-14-2 | Molecular Weight | 243.73000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2-oxo-2-phenylmethoxyethyl)azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18ClNO2 |
|---|---|
| Molecular Weight | 243.73000 |
| Exact Mass | 243.10300 |
| PSA | 26.30000 |
| InChIKey | SWDGDOGJPGGCCA-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC(=O)OCc1ccccc1.[Cl-] |
| HS Code | 2923900090 |
|---|
|
~%
trimethyl-(2-ox... CAS#:3032-14-2 |
| Literature: Plattner; Geiger Helvetica Chimica Acta, 1945 , vol. 28, p. 1362,1367 |
|
~%
trimethyl-(2-ox... CAS#:3032-14-2 |
| Literature: Chem. Fabr. Wiernik and Co. Patent: DE543556 , 1930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 18, p. 2978 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| benzyloxycarbonylmethyl-trimethyl-ammonium,chloride |
| Trimethylammoniumessigsaeurebetain-benzylester-chlorid |
| Benzyloxycarbonylmethyl-trimethyl-ammonium,Chlorid |