1-(4-bromo-3-chlorophenyl)pyrrole-2,5-dione structure
|
Common Name | 1-(4-bromo-3-chlorophenyl)pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 303212-61-5 | Molecular Weight | 286.50900 | |
| Density | 1.808g/cm3 | Boiling Point | 416.2ºC at 760 mmHg | |
| Molecular Formula | C10H5BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.5ºC | |
| Name | 1-(4-bromo-3-chlorophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.808g/cm3 |
|---|---|
| Boiling Point | 416.2ºC at 760 mmHg |
| Molecular Formula | C10H5BrClNO2 |
| Molecular Weight | 286.50900 |
| Flash Point | 205.5ºC |
| Exact Mass | 284.91900 |
| PSA | 37.38000 |
| LogP | 2.59690 |
| Index of Refraction | 1.666 |
| InChIKey | ZMEOYUMKMSZANW-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(Br)c(Cl)c1 |
|
~%
1-(4-bromo-3-ch... CAS#:303212-61-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 56, # 1 p. 254 - 263 |
|
~%
1-(4-bromo-3-ch... CAS#:303212-61-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 56, # 1 p. 254 - 263 |
|
~%
1-(4-bromo-3-ch... CAS#:303212-61-5 |
| Literature: Organic Preparations and Procedures International, , vol. 45, # 4 p. 314 - 320 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(4-Bromo-3-chlorophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione |
| 1-(4-bromo-3-chlorophenyl)-1H-pyrrole-2,5-dione |