Ethanone, 1-phenyl-,2-(2,3,4,5,6-pentafluorophenyl)hydrazone structure
|
Common Name | Ethanone, 1-phenyl-,2-(2,3,4,5,6-pentafluorophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 30332-83-3 | Molecular Weight | 300.22700 | |
| Density | 1.34g/cm3 | Boiling Point | 290.1ºC at 760 mmHg | |
| Molecular Formula | C14H9F5N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.3ºC | |
| Name | 2,3,4,5,6-pentafluoro-N-[(E)-1-phenylethylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 290.1ºC at 760 mmHg |
| Molecular Formula | C14H9F5N2 |
| Molecular Weight | 300.22700 |
| Flash Point | 129.3ºC |
| Exact Mass | 300.06900 |
| PSA | 24.39000 |
| LogP | 4.29120 |
| Index of Refraction | 1.512 |
| InChIKey | VQGWOJKZTIVYLK-IFRROFPPSA-N |
| SMILES | CC(=NNc1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
|
~97%
Ethanone, 1-phe... CAS#:30332-83-3 |
| Literature: Brooke, Gerald M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 821 - 826 |
| acetophenone pentafluorophenylhydrazone |