Benzofuran,7-methoxy-2-nitro- structure
|
Common Name | Benzofuran,7-methoxy-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 30335-71-8 | Molecular Weight | 193.15600 | |
| Density | 1.358g/cm3 | Boiling Point | 315.7ºC at 760mmHg | |
| Molecular Formula | C9H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.7ºC | |
| Name | 7-methoxy-2-nitro-1-benzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 315.7ºC at 760mmHg |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.15600 |
| Flash Point | 144.7ºC |
| Exact Mass | 193.03800 |
| PSA | 68.19000 |
| LogP | 2.87280 |
| Index of Refraction | 1.614 |
| InChIKey | AZXFRACMLPEVGC-UHFFFAOYSA-N |
| SMILES | COc1cccc2cc([N+](=O)[O-])oc12 |
|
~%
Benzofuran,7-me... CAS#:30335-71-8 |
| Literature: Tromelin, Anne; Demerseman, Pierre; Royer, Rene Synthesis, 1985 , # 11 p. 1074 - 1076 |
|
~31%
Benzofuran,7-me... CAS#:30335-71-8 |
| Literature: Ohishi, Yoshitaka; Doi, Yoshio; Nakanishi, Teruo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 11 p. 4260 - 4270 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| methoxy-7 nitro-2 benzofuranne |
| Nitro-2-methoxy-7-benzofuran |
| 2-nitro-7-methoxybenzo<b>furan |
| 7-methoxy-2-nitro-benzofuran |