3-Nitrophenylacetylene
3-Nitrophenylacetylene structure
|
Common Name | 3-Nitrophenylacetylene | ||
|---|---|---|---|---|
| CAS Number | 3034-94-4 | Molecular Weight | 147.131 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 238.1±23.0 °C at 760 mmHg | |
| Molecular Formula | C8H5NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.9±15.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-ethynyl-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 238.1±23.0 °C at 760 mmHg |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.131 |
| Flash Point | 105.9±15.4 °C |
| Exact Mass | 147.032028 |
| PSA | 45.82000 |
| LogP | 2.13 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | JOUOQPWPDONKKS-UHFFFAOYSA-N |
| SMILES | C#Cc1cccc([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-ethynylnitrobenzene |
| 1-Ethynyl-3-nitrobenzene |
| 3-Nitrophenylacetylene |
| m-nitrophenylacetylene |
| 1-Aethinyl-3-nitro-benzol |
| 1-ethynyl-3-nitro-benzene |
| 3-Nitrophenylethyne |
| Benzene,1-ethynyl-3-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-ethynyl-3-nitrobenzene? |
| A: CAS number of 1-ethynyl-3-nitrobenzene is 3034-94-4. |
| Q: What is the SMILES notation of 1-ethynyl-3-nitrobenzene? |
| A: SMILES notation of 1-ethynyl-3-nitrobenzene is C#Cc1cccc([N+](=O)[O-])c1. |
| Q: What is the LogP of 1-ethynyl-3-nitrobenzene? |
| A: LogP of 1-ethynyl-3-nitrobenzene is 2.13. |
| Q: What is the InChIKey of 1-ethynyl-3-nitrobenzene? |
| A: InChIKey of 1-ethynyl-3-nitrobenzene is JOUOQPWPDONKKS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-ethynyl-3-nitrobenzene? |
| A: Molecular formula of 1-ethynyl-3-nitrobenzene is C8H5NO2. |
| Q: What is the polar surface area (PSA) of 1-ethynyl-3-nitrobenzene? |
| A: Polar surface area (PSA) of 1-ethynyl-3-nitrobenzene is 45.82000. |
| Q: What is the boiling point of 1-ethynyl-3-nitrobenzene? |
| A: Boiling point of 1-ethynyl-3-nitrobenzene is 238.1±23.0 °C at 760 mmHg. |
| Q: What English synonyms does 1-ethynyl-3-nitrobenzene have? |
| A: English synonyms of 1-ethynyl-3-nitrobenzene: 3-ethynylnitrobenzene, 1-Ethynyl-3-nitrobenzene, 3-Nitrophenylacetylene, m-nitrophenylacetylene, 1-Aethinyl-3-nitro-benzol, 1-ethynyl-3-nitro-benzene, 3-Nitrophenylethyne, Benzene,1-ethynyl-3-nitro. |
| Q: What is the English name of 1-ethynyl-3-nitrobenzene? |
| A: The English name of 1-ethynyl-3-nitrobenzene is 1-ethynyl-3-nitrobenzene. |
| Q: What is the molecular weight of 1-ethynyl-3-nitrobenzene? |
| A: Molecular weight of 1-ethynyl-3-nitrobenzene is 147.131. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |