7H-Oxazolo[3,2-c]pyrimidin-7-one,2,3,5,6-tetrahydro-2-methyl-8-phenyl-5-thioxo- structure
|
Common Name | 7H-Oxazolo[3,2-c]pyrimidin-7-one,2,3,5,6-tetrahydro-2-methyl-8-phenyl-5-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 30346-03-3 | Molecular Weight | 260.31200 | |
| Density | 1.41g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-8-phenyl-5-sulfanylidene-2,3-dihydro-[1,3]oxazolo[3,2-c]pyrimidin-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.31200 |
| Exact Mass | 260.06200 |
| PSA | 79.11000 |
| LogP | 2.35380 |
| Index of Refraction | 1.699 |
| InChIKey | QVEFQOGPVCJQMF-UHFFFAOYSA-N |
| SMILES | CC1Cn2c(c(-c3ccccc3)c(=O)[nH]c2=S)O1 |
|
~%
7H-Oxazolo[3,2-... CAS#:30346-03-3 |
| Literature: Smissman; Ayres The Journal of organic chemistry, 1971 , vol. 36, # 17 p. 2407 - 2409 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-methyl-8-phenyl-5-thioxo-2,3,5,6-tetrahydro-oxazolo[3,2-c]pyrimidin-7-one |