1,3,5-Triazine-2,4-diamine,6-(chloromethyl)-N2-phenyl- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-(chloromethyl)-N2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 30355-60-3 | Molecular Weight | 235.67300 | |
| Density | 1.427g/cm3 | Boiling Point | 478.3ºC at 760 mmHg | |
| Molecular Formula | C10H10ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.1ºC | |
| Name | 6-(chloromethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 478.3ºC at 760 mmHg |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.67300 |
| Flash Point | 243.1ºC |
| Exact Mass | 235.06200 |
| PSA | 76.72000 |
| LogP | 2.59040 |
| Index of Refraction | 1.701 |
| InChIKey | ZEXYPLRLARKYLF-UHFFFAOYSA-N |
| SMILES | Nc1nc(CCl)nc(Nc2ccccc2)n1 |
| HS Code | 2933699090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| [4-amino-6-(chloromethyl)(1,3,5-triazin-2-yl)]phenylamine |
| 6-Chlormethyl-N2-phenyl-[1,3,5]triazin-2,4-diyldiamin |
| 6-(Chloromethyl)-N-Phenyl-1,3,5-Triazine-2,4-Diamine |
| 4-Chlormethyl-6-(phenylamino)-2-amino-symm.-triazin |
| 6-chloromethyl-N2-phenyl-[1,3,5]triazine-2,4-diyldiamine |