N-(4-nitrophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine structure
|
Common Name | N-(4-nitrophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 30356-66-2 | Molecular Weight | 451.90800 | |
| Density | 1.81g/cm3 | Boiling Point | 515.4ºC at 760mmHg | |
| Molecular Formula | C11H5Cl6N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.5ºC | |
| Name | N-(4-nitrophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 515.4ºC at 760mmHg |
| Molecular Formula | C11H5Cl6N5O2 |
| Molecular Weight | 451.90800 |
| Flash Point | 265.5ºC |
| Exact Mass | 448.85700 |
| PSA | 96.52000 |
| LogP | 5.77300 |
| Index of Refraction | 1.681 |
| InChIKey | RXIJZWRKDDMFQA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| (4,6-bis-trichloromethyl-[1,3,5]triazin-2-yl)-(4-nitro-phenyl)-amine |
| 1,3,5-Triazin-2-amine,N-(4-nitrophenyl)-4,6-bis(trichloromethyl) |
| s-Triazine,2-(p-nitroanilino)-4,6-bis(trichloromethyl)-(8CI) |