N-pyridin-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine structure
|
Common Name | N-pyridin-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 30356-70-8 | Molecular Weight | 407.89800 | |
| Density | 1.765g/cm3 | Boiling Point | 466.2ºC at 760mmHg | |
| Molecular Formula | C10H5Cl6N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | N-pyridin-2-yl-4,6-bis(trichloromethyl)-1,3,5-triazin-2-amine |
|---|
| Density | 1.765g/cm3 |
|---|---|
| Boiling Point | 466.2ºC at 760mmHg |
| Molecular Formula | C10H5Cl6N5 |
| Molecular Weight | 407.89800 |
| Flash Point | 235.7ºC |
| Exact Mass | 404.86800 |
| PSA | 66.82000 |
| LogP | 4.08550 |
| Index of Refraction | 1.667 |
| InChIKey | ISEJOZCZKKOJRP-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)c1nc(Nc2ccccn2)nc(C(Cl)(Cl)Cl)n1 |
|
~%
N-pyridin-2-yl-... CAS#:30356-70-8 |
| Literature: Schroeder Journal of the American Chemical Society, 1959 , vol. 81, p. 5658,5662 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |