ethyl 4-amino-6-(trichloromethyl)-1,3,5-triazine-2-carboxylate
Modify Date: 2025-09-22 21:15:24
ethyl 4-amino-6-(trichloromethyl)-1,3,5-triazine-2-carboxylate structure
|
Common Name | ethyl 4-amino-6-(trichloromethyl)-1,3,5-triazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 30362-19-7 | Molecular Weight | 285.51500 | |
| Density | 1.612g/cm3 | Boiling Point | 410ºC at 760mmHg | |
| Molecular Formula | C7H7Cl3N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | ethyl 4-amino-6-(trichloromethyl)-1,3,5-triazine-2-carboxylate |
|---|
| Density | 1.612g/cm3 |
|---|---|
| Boiling Point | 410ºC at 760mmHg |
| Molecular Formula | C7H7Cl3N4O2 |
| Molecular Weight | 285.51500 |
| Flash Point | 201.7ºC |
| Exact Mass | 283.96300 |
| PSA | 91.72000 |
| LogP | 1.38730 |
| Index of Refraction | 1.595 |
| InChIKey | OBRMNGGSPAAIAC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc(N)nc(C(Cl)(Cl)Cl)n1 |
| HS Code | 2933699090 |
|---|
|
~%
ethyl 4-amino-6... CAS#:30362-19-7 |
| Literature: Kreutzberger Journal of the American Chemical Society, 1957 , vol. 79, p. 2629,2632 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |