2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-yl acetate
Modify Date: 2025-09-29 12:17:11
![2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-yl acetate Structure](https://image.chemsrc.com/caspic/346/30362-47-1.png)
2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-yl acetate structure
|
Common Name | 2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 30362-47-1 | Molecular Weight | 415.91500 | |
| Density | 1.609g/cm3 | Boiling Point | 423.4ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl6N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.8ºC | |
| Name | 2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]propan-2-yl acetate |
|---|
| Density | 1.609g/cm3 |
|---|---|
| Boiling Point | 423.4ºC at 760 mmHg |
| Molecular Formula | C10H9Cl6N3O2 |
| Molecular Weight | 415.91500 |
| Flash Point | 209.8ºC |
| Exact Mass | 412.88300 |
| PSA | 64.97000 |
| LogP | 4.32320 |
| Index of Refraction | 1.558 |
| InChIKey | OUUVNPPQMNAVFU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C)(C)c1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |