N-(3-bromophenyl)-4,6-dichloro-1,3,5-triazin-2-amine structure
|
Common Name | N-(3-bromophenyl)-4,6-dichloro-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 30369-85-8 | Molecular Weight | 319.97300 | |
| Density | 1.825g/cm3 | Boiling Point | 479.3ºC at 760mmHg | |
| Molecular Formula | C9H5BrCl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.7ºC | |
| Name | N-(3-bromophenyl)-4,6-dichloro-1,3,5-triazin-2-amine |
|---|
| Density | 1.825g/cm3 |
|---|---|
| Boiling Point | 479.3ºC at 760mmHg |
| Molecular Formula | C9H5BrCl2N4 |
| Molecular Weight | 319.97300 |
| Flash Point | 243.7ºC |
| Exact Mass | 317.90700 |
| PSA | 53.93000 |
| LogP | 3.10640 |
| Index of Refraction | 1.695 |
| InChIKey | PPUNTDWTGGIFIJ-UHFFFAOYSA-N |
| SMILES | Clc1nc(Cl)nc(Nc2cccc(Br)c2)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |