2-[2-(Trifluoromethyl)benzyl]-2-imidazoline
Modify Date: 2025-09-12 12:19:02
![2-[2-(Trifluoromethyl)benzyl]-2-imidazoline Structure](https://image.chemsrc.com/caspic/288/3038-49-1.png)
2-[2-(Trifluoromethyl)benzyl]-2-imidazoline structure
|
Common Name | 2-[2-(Trifluoromethyl)benzyl]-2-imidazoline | ||
|---|---|---|---|---|
| CAS Number | 3038-49-1 | Molecular Weight | 228.21400 | |
| Density | 1.29g/cm3 | Boiling Point | 325.7ºC at 760 mmHg | |
| Molecular Formula | C11H11F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.8ºC | |
| Name | 2-[[2-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-imidazole |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 325.7ºC at 760 mmHg |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.21400 |
| Flash Point | 150.8ºC |
| Exact Mass | 228.08700 |
| PSA | 24.39000 |
| LogP | 2.01400 |
| Index of Refraction | 1.529 |
| InChIKey | BLGSIJYJOUMJMW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccccc1CC1=NCCN1 |
| HS Code | 2933290090 |
|---|
|
~95%
2-[2-(Trifluoro... CAS#:3038-49-1 |
| Literature: Huh, Dal Ho; Ryu, Hoejin; Kim, Young Gyu Tetrahedron, 2004 , vol. 60, # 44 p. 9857 - 9862 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |