N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide
![N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide Structure](https://image.chemsrc.com/caspic/338/30384-83-9.png)
N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide structure
|
Common Name | N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 30384-83-9 | Molecular Weight | 339.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-[1-(1H-Benzimidazol-2-yl)-2-phenylethenyl]benzamide, CAS 30384-83-9, molecular formula C22H17N3O, molecular weight 339.39. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H17N3O |
|---|---|
| Molecular Weight | 339.39000 |
| Exact Mass | 339.13700 |
| PSA | 61.27000 |
| LogP | 5.06580 |
| InChIKey | JTRYWBLMSLZKNJ-HMMYKYKNSA-N |
| SMILES | O=C(NC(=Cc1ccccc1)c1nc2ccccc2[nH]1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![N-[3-(2-aminoanilino)-3-oxo-1-phenylprop-1-en-2-yl]benzamide structure](https://image.chemsrc.com/caspic/350/88820-20-6.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Anti-inflammatory activity against Rattus norvegicus Wistar albino (rat) assessed as ...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3061338
|
|
Name: Anti-inflammatory activity against Rattus norvegicus Wistar albino (rat) assessed as ...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3061718
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: The English name of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide is N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide. |
| Q: What is the InChIKey of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: InChIKey of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide is JTRYWBLMSLZKNJ-HMMYKYKNSA-N. |
| Q: What is the molecular weight of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: Molecular weight of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide is 339.39000. |
| Q: What is the SMILES notation of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: SMILES notation of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide is O=C(NC(=Cc1ccccc1)c1nc2ccccc2[nH]1)c1ccccc1. |
| Q: What is the molecular formula of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: Molecular formula of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide is C22H17N3O. |
| Q: What is the LogP of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: LogP of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide is 5.06580. |
| Q: What are the upstream materials of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: Related upstream materials(CAS) of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide: 842-74-0;95-54-5;88820-20-6;1199-01-5;100-52-7. |
| Q: What is the Chinese name of 30384-83-9? |
| A: Chinese name of 30384-83-9 is 30384-83-9. |
| Q: What is the CAS number of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: CAS number of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide is 30384-83-9. |
| Q: What is the polar surface area (PSA) of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide? |
| A: Polar surface area (PSA) of N-[1-(1H-benzimidazol-2-yl)-2-phenylethenyl]benzamide is 61.27000. |