bitolterol structure
|
Common Name | bitolterol | ||
|---|---|---|---|---|
| CAS Number | 30392-40-6 | Molecular Weight | 461.54900 | |
| Density | 1.169g/cm3 | Boiling Point | 640.5ºC at 760 mmHg | |
| Molecular Formula | C28H31NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.2ºC | |
| Name | bitolterol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 640.5ºC at 760 mmHg |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.54900 |
| Flash Point | 341.2ºC |
| Exact Mass | 461.22000 |
| PSA | 84.86000 |
| LogP | 5.55420 |
| Index of Refraction | 1.585 |
| InChIKey | FZGVEKPRDOIXJY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(O)CNC(C)(C)C)cc2OC(=O)c2ccc(C)cc2)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Bitolterolum |
| S 1540 |
| [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate |
| Bitolterol |