Reutericyclin structure
|
Common Name | Reutericyclin | ||
|---|---|---|---|---|
| CAS Number | 303957-69-9 | Molecular Weight | 349.46400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H31NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ReutericyclinReutericyclin (Reutericycline), a unique tetramic acid, is an antibiotic produced by some strains of Lactobacillus reuteri. Reutericyclin (Reutericycline) exhibits a broad inhibitory spectrum including Lactobacillus spp., Bacillus subtilis, B. cereus, Enterococcus faecalis, Staphylococcus aureus, and Listeria innocua[1][2]. |
| Name | (R)-reutericyclin |
|---|---|
| Synonym | More Synonyms |
| Description | Reutericyclin (Reutericycline), a unique tetramic acid, is an antibiotic produced by some strains of Lactobacillus reuteri. Reutericyclin (Reutericycline) exhibits a broad inhibitory spectrum including Lactobacillus spp., Bacillus subtilis, B. cereus, Enterococcus faecalis, Staphylococcus aureus, and Listeria innocua[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H31NO4 |
|---|---|
| Molecular Weight | 349.46400 |
| Exact Mass | 349.22500 |
| PSA | 74.68000 |
| LogP | 4.02560 |
| InChIKey | GNGSBVNLHSNSDF-LPQFERQCSA-N |
| SMILES | CCCCCCCC=CC(=O)N1C(=O)C(C(C)=O)=C(O)C1CC(C)C |
| Reutericyclin |
| (2R)-4-acetyl-1,2-dihydro-5-hydroxy-2-(2-methylpropyl)-1-[(2E)-1-oxodec-2-enyl]-3H-pyrrol-3-one |
| (5R)-3-Acetyl-1-(2-decenoyl)-2-hydroxy-5-isobutyl-Δ2-pyrroline-4-one |
| (R)-4-Acetyl-1-((E)-dec-2-enoyl)-5-hydroxy-2-isobutyl-1,2-dihydro-pyrrol-3-one |