3,4-dimethyl-2-(3-nitrophenyl)-5-phenyl-1,3-oxazolidine structure
|
Common Name | 3,4-dimethyl-2-(3-nitrophenyl)-5-phenyl-1,3-oxazolidine | ||
|---|---|---|---|---|
| CAS Number | 30403-79-3 | Molecular Weight | 298.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-dimethyl-2-(3-nitrophenyl)-5-phenyl-1,3-oxazolidine |
|---|
| Molecular Formula | C17H18N2O3 |
|---|---|
| Molecular Weight | 298.33600 |
| Exact Mass | 298.13200 |
| PSA | 58.29000 |
| LogP | 4.14630 |
| InChIKey | WZMZZFUSNQHBIR-UHFFFAOYSA-N |
| SMILES | CC1C(c2ccccc2)OC(c2cccc([N+](=O)[O-])c2)N1C |
|
~%
3,4-dimethyl-2-... CAS#:30403-79-3 |
| Literature: Bergmann; Resnick Journal of the Chemical Society, 1956 , p. 1662,1665 Full Text Show Details Foeldi Acta Chimica Academiae Scientiarum Hungaricae, 1957 , vol. 10, p. 1,2 Chem.Abstr., 1960 , # 6620 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |