methyl 2-naphthalen-2-yloxypropanoate
methyl 2-naphthalen-2-yloxypropanoate structure
|
Common Name | methyl 2-naphthalen-2-yloxypropanoate | ||
|---|---|---|---|---|
| CAS Number | 30406-75-8 | Molecular Weight | 230.25900 | |
| Density | 1.145g/cm3 | Boiling Point | 346.9ºC at 760mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144ºC | |
Summary: Methyl 2-naphthalen-2-yloxypropanoate, CAS号30406-75-8, molecular formula C14H14O3, molecular weight 230.25900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-naphthalen-2-yloxypropanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 346.9ºC at 760mmHg |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.25900 |
| Flash Point | 144ºC |
| Exact Mass | 230.09400 |
| PSA | 35.53000 |
| LogP | 2.78010 |
| Index of Refraction | 1.575 |
| InChIKey | XPUKIATWMAOOFP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)Oc1ccc2ccccc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
methyl 2-naphth... CAS#:30406-75-8 |
| Literature: Lin, Yu-Sheng; Lin, Chiao-Yang; Liu, Chih-Wei; Tsai, Thomas Y.R. Tetrahedron, 2006 , vol. 62, # 5 p. 872 - 877 |
|
~97%
methyl 2-naphth... CAS#:30406-75-8 |
| Literature: Koul, Surrinder; Koul, Jawahir Lal; Singh, Budh; Kapoor, Munish; Parshad, Rajinder; Manhas, Kuldeep S.; Taneja, Subhash C.; Qazi, Ghulam N. Tetrahedron Asymmetry, 2005 , vol. 16, # 15 p. 2575 - 2591 |
|
~%
methyl 2-naphth... CAS#:30406-75-8 |
| Literature: Koul, Surrinder; Koul, Jawahir Lal; Singh, Budh; Kapoor, Munish; Parshad, Rajinder; Manhas, Kuldeep S.; Taneja, Subhash C.; Qazi, Ghulam N. Tetrahedron Asymmetry, 2005 , vol. 16, # 15 p. 2575 - 2591 |
|
~%
methyl 2-naphth... CAS#:30406-75-8 |
| Literature: Koul, Surrinder; Koul, Jawahir Lal; Singh, Budh; Kapoor, Munish; Parshad, Rajinder; Manhas, Kuldeep S.; Taneja, Subhash C.; Qazi, Ghulam N. Tetrahedron Asymmetry, 2005 , vol. 16, # 15 p. 2575 - 2591 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| nopm |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of methyl 2-naphthalen-2-yloxypropanoate? |
| A: LogP of methyl 2-naphthalen-2-yloxypropanoate is 2.78010. |
| Q: What is the SMILES notation of methyl 2-naphthalen-2-yloxypropanoate? |
| A: SMILES notation of methyl 2-naphthalen-2-yloxypropanoate is COC(=O)C(C)Oc1ccc2ccccc2c1. |
| Q: What English synonyms does methyl 2-naphthalen-2-yloxypropanoate have? |
| A: English synonyms of methyl 2-naphthalen-2-yloxypropanoate: nopm. |
| Q: What is the molecular formula of methyl 2-naphthalen-2-yloxypropanoate? |
| A: Molecular formula of methyl 2-naphthalen-2-yloxypropanoate is C14H14O3. |
| Q: What is the English name of methyl 2-naphthalen-2-yloxypropanoate? |
| A: The English name of methyl 2-naphthalen-2-yloxypropanoate is methyl 2-naphthalen-2-yloxypropanoate. |
| Q: What is the Chinese name of 30406-75-8? |
| A: Chinese name of 30406-75-8 is 30406-75-8. |
| Q: What is the boiling point of methyl 2-naphthalen-2-yloxypropanoate? |
| A: Boiling point of methyl 2-naphthalen-2-yloxypropanoate is 346.9ºC at 760mmHg. |
| Q: What are the upstream materials of methyl 2-naphthalen-2-yloxypropanoate? |
| A: Related upstream materials(CAS) of methyl 2-naphthalen-2-yloxypropanoate: 547-64-8;135-19-3;67-56-1;62782-37-0;10470-82-3. |
| Q: What is the CAS number of methyl 2-naphthalen-2-yloxypropanoate? |
| A: CAS number of methyl 2-naphthalen-2-yloxypropanoate is 30406-75-8. |
| Q: What is the molecular weight of methyl 2-naphthalen-2-yloxypropanoate? |
| A: Molecular weight of methyl 2-naphthalen-2-yloxypropanoate is 230.25900. |