7-methylsulfonyloxyheptyl methanesulfonate
Modify Date: 2025-08-27 18:32:39
7-methylsulfonyloxyheptyl methanesulfonate structure
|
Common Name | 7-methylsulfonyloxyheptyl methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 30412-10-3 | Molecular Weight | 288.38200 | |
| Density | 1.243g/cm3 | Boiling Point | 481.8ºC at 760mmHg | |
| Molecular Formula | C9H20O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.2ºC | |
| Name | 7-methylsulfonyloxyheptyl methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 481.8ºC at 760mmHg |
| Molecular Formula | C9H20O6S2 |
| Molecular Weight | 288.38200 |
| Flash Point | 245.2ºC |
| Exact Mass | 288.07000 |
| PSA | 103.50000 |
| LogP | 3.05090 |
| Index of Refraction | 1.471 |
| InChIKey | UMQMIJCGXPPDCZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCCCCCCOS(C)(=O)=O |
|
~49%
7-methylsulfony... CAS#:30412-10-3 |
| Literature: Cheng, P.; Blumstein, A.; Subramanyam, S. Molecular Crystals and Liquid Crystals Science and Technology, Section A: Molecular Crystals and Liquid Crystals, 1995 , vol. 269, p. 1 - 38 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Heptane dimethanesulphonate |
| heptane-1,7-diyl dimethanesulfonate |
| 1,7-Heptanediol,dimethanesulfonate |