N-[(E)-(4-chlorophenyl)methylideneamino]-2,4-dihydroxybenzamide structure
|
Common Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2,4-dihydroxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 304481-26-3 | Molecular Weight | 290.70200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2,4-dihydroxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11ClN2O3 |
|---|---|
| Molecular Weight | 290.70200 |
| Exact Mass | 290.04600 |
| PSA | 85.41000 |
| LogP | 3.08990 |
| InChIKey | ATMRFAJBWMCZCX-LZYBPNLTSA-N |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)c1ccc(O)cc1O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| EX-41-103 |
| N'-(4-chlorobenzylidene)-2,4-dihydroxybenzohydrazide |
| N'-[(E)-(4-chlorophenyl)methylidene]-2,4-dihydroxybenzohydrazide |