1H-Imidazole,4-nitro-1-(2,4,6-trinitrophenyl)- structure
|
Common Name | 1H-Imidazole,4-nitro-1-(2,4,6-trinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 30454-76-3 | Molecular Weight | 324.16300 | |
| Density | 2.05g/cm3 | Boiling Point | 563.7ºC at 760mmHg | |
| Molecular Formula | C9H4N6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.7ºC | |
| Name | 4-nitro-1-(2,4,6-trinitrophenyl)imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.05g/cm3 |
|---|---|
| Boiling Point | 563.7ºC at 760mmHg |
| Molecular Formula | C9H4N6O8 |
| Molecular Weight | 324.16300 |
| Flash Point | 294.7ºC |
| Exact Mass | 324.00900 |
| PSA | 201.10000 |
| LogP | 3.59790 |
| Index of Refraction | 1.82 |
| InChIKey | JGDFIPYCBGKKND-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(-n2cnc([N+](=O)[O-])c2)c([N+](=O)[O-])c1 |
|
~85%
1H-Imidazole,4-... CAS#:30454-76-3 |
| Literature: Hou, Kehui; Liu, Zuliang Chinese Journal of Chemistry, 2013 , vol. 31, # 2 p. 243 - 246 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(2',4',6'-trinitrophenyl)-4-nitroimidazole |
| 4-Nitro-1-pikrylimidazol |
| 4-nitro-1-(2,4,6-trinitro-phenyl)-1H-imidazole |
| 2-Nitro-1-pikrylimidazol |