akos b018350 structure
|
Common Name | akos b018350 | ||
|---|---|---|---|---|
| CAS Number | 304861-41-4 | Molecular Weight | 279.33500 | |
| Density | 1.47g/cm3 | Boiling Point | 442.8ºC at 760 mmHg | |
| Molecular Formula | C12H9NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
| Name | akos b018350 |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 442.8ºC at 760 mmHg |
| Molecular Formula | C12H9NO3S2 |
| Molecular Weight | 279.33500 |
| Flash Point | 221.6ºC |
| Exact Mass | 279.00200 |
| PSA | 119.83000 |
| LogP | 1.80890 |
| Index of Refraction | 1.694 |
| InChIKey | JGFXKXPPIIPAFJ-TWGQIWQCSA-N |
| SMILES | COC(=O)c1ccc(C=C2SC(=S)NC2=O)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |