6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile structure
|
Common Name | 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 304875-69-2 | Molecular Weight | 384.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24N4O4 |
|---|---|
| Molecular Weight | 384.4 |
| InChIKey | NOVGDXHVCAGIHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C2C(C(=C(OC2=NN1)N)C#N)C3=CC(=C(C(=C3)OC)OC)OC |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile? |
| A: Molecular weight of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile is 384.4. |
| Q: What is the English name of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile? |
| A: The English name of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile is 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile. |
| Q: What is the Chinese name of 304875-69-2? |
| A: Chinese name of 304875-69-2 is 304875-69-2. |
| Q: What is the CAS number of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile? |
| A: CAS number of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile is 304875-69-2. |
| Q: What is the SMILES notation of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile? |
| A: SMILES notation of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile is CC(C)(C)C1=C2C(C(=C(OC2=NN1)N)C#N)C3=CC(=C(C(=C3)OC)OC)OC. |
| Q: What is the molecular formula of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile? |
| A: Molecular formula of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile is C20H24N4O4. |
| Q: What is the InChIKey of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile? |
| A: InChIKey of 6-Amino-3-(tert-butyl)-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile is NOVGDXHVCAGIHE-UHFFFAOYSA-N. |