Benzeneacetamide,N-[2-(3,4-dimethoxyphenyl)ethyl]-a-phenyl- structure
|
Common Name | Benzeneacetamide,N-[2-(3,4-dimethoxyphenyl)ethyl]-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 30488-64-3 | Molecular Weight | 375.46000 | |
| Density | 1.124g/cm3 | Boiling Point | 585.1ºC at 760mmHg | |
| Molecular Formula | C24H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.7ºC | |
| Name | N-(2-(3,4-dimethoxyphenyl)ethyl)-2,2-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 585.1ºC at 760mmHg |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.46000 |
| Flash Point | 307.7ºC |
| Exact Mass | 375.18300 |
| PSA | 47.56000 |
| LogP | 4.58550 |
| Index of Refraction | 1.579 |
| InChIKey | ATNUUEWRLXGFSA-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)C(c2ccccc2)c2ccccc2)cc1OC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2-(3-(piperazin-1-ylmethyl)imidazo[2,1-b]thiazol-6-yl)phenyl)quinoxaline-2-carboxamide |