(2Z,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one structure
|
Common Name | (2Z,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 30511-76-3 | Molecular Weight | 285.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2Z,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19NO3 |
|---|---|
| Molecular Weight | 285.33800 |
| Exact Mass | 285.13600 |
| PSA | 38.77000 |
| LogP | 2.93510 |
| InChIKey | MXXWOMGUGJBKIW-BPMFVRGZSA-N |
| SMILES | O=C(C=CC=Cc1ccc2c(c1)OCO2)N1CCCCC1 |
|
~%
(2Z,4E)-5-(1,3-... CAS#:30511-76-3 |
| Literature: Kozukue, Nobuyuki; Park, Mal-Sun; Choi, Suk-Hyun; Lee, Seung-Un; Ohnishi-Kameyama, Mayumi; Levin, Carol E.; Friedman, Mendel Journal of Agricultural and Food Chemistry, 2007 , vol. 55, # 17 p. 7131 - 7139 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Piperidine,4-methylenedioxyphenyl)-1-oxo-2,4-pentadienyl] |
| cis-trans-Piperin |
| Isopeperine |
| Isopiperine |
| Piperidine,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl] |
| UNII-Z3C7H03C5M |