3,3-dichloro-4,4,4-trifluoro-2-methylbutan-2-ol structure
|
Common Name | 3,3-dichloro-4,4,4-trifluoro-2-methylbutan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 30517-64-7 | Molecular Weight | 211.01000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H7Cl2F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-dichloro-4,4,4-trifluoro-2-methylbutan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H7Cl2F3O |
|---|---|
| Molecular Weight | 211.01000 |
| Exact Mass | 209.98300 |
| PSA | 20.23000 |
| LogP | 2.49350 |
| InChIKey | RPHGABSDHONMPT-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(Cl)(Cl)C(F)(F)F |
|
~19%
3,3-dichloro-4,... CAS#:30517-64-7 |
| Literature: Hemer,I.; Posta,A. Journal of Fluorine Chemistry, 1984 , vol. 26, p. 467 |
|
~5%
3,3-dichloro-4,... CAS#:30517-64-7 |
| Literature: Hemer,I.; Posta,A. Journal of Fluorine Chemistry, 1984 , vol. 26, p. 467 |
|
~%
3,3-dichloro-4,... CAS#:30517-64-7 |
| Literature: Seyferth,D. et al. Organometallics in Chemical Synthesis, 1970 , vol. 1, p. 3 - 6 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1,1,1-Trifluor-2,2-dichlor-3-methyl-3-butanol |
| 2-Butanol,3,3-dichloro-4,4,4-trifluoro-2-methyl |
| 3,3-dichloro-4,4,4-trifluoro-2-methyl-butan-2-ol |
| 2,2-dichloro-3,3,3-trifluoro-1,1-dimethyl-propanol |