2-benzylsulfanyl-1,3-thiazine-4,6-dione structure
|
Common Name | 2-benzylsulfanyl-1,3-thiazine-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 30531-08-9 | Molecular Weight | 251.32500 | |
| Density | 1.38g/cm3 | Boiling Point | 409.9ºC at 760mmHg | |
| Molecular Formula | C11H9NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | 2-benzylsulfanyl-1,3-thiazine-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760mmHg |
| Molecular Formula | C11H9NO2S2 |
| Molecular Weight | 251.32500 |
| Flash Point | 201.7ºC |
| Exact Mass | 251.00700 |
| PSA | 97.10000 |
| LogP | 1.90150 |
| Index of Refraction | 1.681 |
| InChIKey | IASGZQREPXNBJR-UHFFFAOYSA-N |
| SMILES | O=C1CC(=O)SC(SCc2ccccc2)=N1 |
|
~%
2-benzylsulfany... CAS#:30531-08-9 |
| Literature: Beilin,V.G. et al. Journal of Organic Chemistry USSR (English Translation), 1970 , vol. 6, p. 2617 - 2619 Zhurnal Organicheskoi Khimii, 1970 , vol. 6, p. 2609 - 2612 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-benzylthio-4,6-dioxo-5,6-dihydro-4H-1,3-thiazine |
| 2-Benzylthiodihydro-1,3-thiazin-4,6-dion |