Acetic acid, 2-nitro-,phenylmethyl ester structure
|
Common Name | Acetic acid, 2-nitro-,phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 30563-27-0 | Molecular Weight | 195.17200 | |
| Density | 1.259g/cm3 | Boiling Point | 304.6ºC at 760mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.1ºC | |
| Name | benzyl 2-nitroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 304.6ºC at 760mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 141.1ºC |
| Exact Mass | 195.05300 |
| PSA | 72.12000 |
| LogP | 1.52970 |
| Index of Refraction | 1.534 |
| InChIKey | BJADPMIJHRXIRO-UHFFFAOYSA-N |
| SMILES | O=C(C[N+](=O)[O-])OCc1ccccc1 |
| HS Code | 2915900090 |
|---|
|
~87%
Acetic acid, 2-... CAS#:30563-27-0 |
| Literature: Sylvain, Catherine; Wagner, Alain; Mioskowski, Charles Tetrahedron Letters, 1999 , vol. 40, # 5 p. 875 - 878 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Acetic acid,nitro-,phenylmethyl ester(9CI) |
| nitroacetic acid benzyl ester |
| Aceticacid,nitro-,benzyl ester (6CI,8CI) |
| Benzyl nitroacetate |
| Nitroessigsaeure-benzylester |
| Acetic acid,2-nitro-,phenylmethyl ester |