SAYANEDINE structure
|
Common Name | SAYANEDINE | ||
|---|---|---|---|---|
| CAS Number | 30564-92-2 | Molecular Weight | 298.29000 | |
| Density | 1.321g/cm3 | Boiling Point | 503ºC at 760 mmHg | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2ºC | |
| Name | 3-(4-hydroxy-3-methoxyphenyl)-7-methoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 503ºC at 760 mmHg |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29000 |
| Flash Point | 188.2ºC |
| Exact Mass | 298.08400 |
| PSA | 68.90000 |
| LogP | 3.18280 |
| Index of Refraction | 1.621 |
| InChIKey | JSDXTLJPMLRQOB-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)c(-c3ccc(O)c(OC)c3)coc2c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Sayanedine |