2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-dicarboxylicacid, 3,9-dimethyl ester structure
|
Common Name | 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-dicarboxylicacid, 3,9-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 3058-09-1 | Molecular Weight | 276.24000 | |
| Density | 1.34g/cm3 | Boiling Point | 401.6ºC at 760 mmHg | |
| Molecular Formula | C11H16O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.7ºC | |
| Name | dimethyl 2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-dicarboxylate |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760 mmHg |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24000 |
| Flash Point | 179.7ºC |
| Exact Mass | 276.08500 |
| PSA | 89.52000 |
| Index of Refraction | 1.489 |
| InChIKey | KVTIIRWSQVXMGO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1OCC2(CO1)COC(C(=O)OC)OC2 |
| HS Code | 2932999099 |
|---|
|
~%
2,4,8,10-Tetrao... CAS#:3058-09-1 |
| Literature: Clements; Rice Journal of Organic Chemistry, 1959 , vol. 24, p. 1958,1961 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |