2,4-O-Benzylidene-L-xylose structure
|
Common Name | 2,4-O-Benzylidene-L-xylose | ||
|---|---|---|---|---|
| CAS Number | 30608-02-7 | Molecular Weight | 238.23700 | |
| Density | 1.362g/cm3 | Boiling Point | 458.1ºC at 760mmHg | |
| Molecular Formula | C12H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.4ºC | |
| Name | (4S,5R,6S)-5-hydroxy-6-(hydroxymethyl)-2-phenyl-1,3-dioxane-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 458.1ºC at 760mmHg |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.23700 |
| Flash Point | 180.4ºC |
| Exact Mass | 238.08400 |
| PSA | 75.99000 |
| LogP | 0.02130 |
| Index of Refraction | 1.608 |
| InChIKey | MLCKHSIBLXIZKN-FEZOTEKNSA-N |
| SMILES | O=CC1OC(c2ccccc2)OC(CO)C1O |
| HS Code | 2934999090 |
|---|
|
~%
2,4-O-Benzylide... CAS#:30608-02-7 |
| Literature: Ray, Rathindra Nath Journal of the Indian Chemical Society, 1987 , vol. 64, # 6 p. 371 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Benzyliden-L-xylose |
| 2,4-benzylidene-L-xylose |
| 2,4-O-Benzylidene-L-xylose |