magnesium,diphenylmethylbenzene,bromide structure
|
Common Name | magnesium,diphenylmethylbenzene,bromide | ||
|---|---|---|---|---|
| CAS Number | 30615-54-4 | Molecular Weight | 347.53100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | magnesium,diphenylmethylbenzene,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H15BrMg |
|---|---|
| Molecular Weight | 347.53100 |
| Exact Mass | 346.02100 |
| LogP | 1.70980 |
| InChIKey | UKWOVDLJUPEGKM-UHFFFAOYSA-M |
| SMILES | [Br-].[Mg+2].c1ccc([C-](c2ccccc2)c2ccccc2)cc1 |
|
~%
magnesium,diphe... CAS#:30615-54-4 |
| Literature: Holm, Torkil Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1981 , p. 464 - 467 |
|
~%
magnesium,diphe... CAS#:30615-54-4 |
| Literature: Gomberg; Bachmann Journal of the American Chemical Society, 1930 , vol. 52, p. 2455,2459 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| Triphenylmethyl-magnesiumbromid |