D-glycero-D-gulo-heptono-.delta.-lactone structure
|
Common Name | D-glycero-D-gulo-heptono-.delta.-lactone | ||
|---|---|---|---|---|
| CAS Number | 3063-04-5 | Molecular Weight | 208.16600 | |
| Density | 1.801g/cm3 | Boiling Point | 540.7ºC at 760 mmHg | |
| Molecular Formula | C7H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.3ºC | |
| Name | D-glycero-D-gulo-heptono-.δ.-lactone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.801g/cm3 |
|---|---|
| Boiling Point | 540.7ºC at 760 mmHg |
| Molecular Formula | C7H12O7 |
| Molecular Weight | 208.16600 |
| Flash Point | 225.3ºC |
| Exact Mass | 208.05800 |
| PSA | 127.45000 |
| Index of Refraction | 1.644 |
| InChIKey | SUNCWTXGGFSVJR-QZABAPFNSA-N |
| SMILES | O=C1OC(C(O)CO)C(O)C(O)C1O |
|
~%
D-glycero-D-gul... CAS#:3063-04-5 |
| Literature: Gallas, Katharina; Pototschnig, Gerit; Adanitsch, Florian; Stuetz, Arnold E.; Wrodnigg, Tanja M. Beilstein Journal of Organic Chemistry, 2012 , vol. 8, p. 1619 - 1629,11 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-one |
| a-D-GlucoheptonicLactone |
| (3R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxy-tetrahydropyran-2-one |
| D-glycero-D-gluco-Heptonic acid 1,5-lactone |