2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid structure
|
Common Name | 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 306320-92-3 | Molecular Weight | 295.28900 | |
| Density | 1.393g/cm3 | Boiling Point | 547.5ºC at 760 mmHg | |
| Molecular Formula | C17H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.9ºC | |
| Name | 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 547.5ºC at 760 mmHg |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.28900 |
| Flash Point | 284.9ºC |
| Exact Mass | 295.08400 |
| PSA | 74.68000 |
| LogP | 2.86720 |
| Index of Refraction | 1.664 |
| InChIKey | SIWXMKDPCUAHIK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)O)cc3C2=O)c1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |