Decahydro-2,6-naphthalenedicarboxylic Acid Dimethyl Ester structure
|
Common Name | Decahydro-2,6-naphthalenedicarboxylic Acid Dimethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 3068-02-8 | Molecular Weight | 254.32200 | |
| Density | 1.088g/cm3 | Boiling Point | 140ºC / 0.2mmHg | |
| Molecular Formula | C14H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.1ºC | |
| Name | dimethyl 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 140ºC / 0.2mmHg |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.32200 |
| Flash Point | 142.1ºC |
| Exact Mass | 254.15200 |
| PSA | 52.60000 |
| LogP | 2.16500 |
| Index of Refraction | 1.477 |
| InChIKey | XYHMJVZAEWACCS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2CC(C(=O)OC)CCC2C1 |
| HS Code | 2917209090 |
|---|
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| D3745 |
| Decahydro-2,6-naphthalenedicarboxylic Acid Dimethyl Ester |
| Decahydro-naphthalin-2,6-dicarbonsaeure-dimethylester |
| Dimethyl Decahydro-2,6-naphthalenedicarboxylate |
| DiMethyl Decahydro-2,6-naphthalenedicarboxylate |