2-[1-[[4-[(3-pyridin-2-ylpyrazol-1-yl)methyl]phenyl]methyl]pyrazol-3-yl]pyridine structure
|
Common Name | 2-[1-[[4-[(3-pyridin-2-ylpyrazol-1-yl)methyl]phenyl]methyl]pyrazol-3-yl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 306974-22-1 | Molecular Weight | 392.45600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[1-[[4-[(3-pyridin-2-ylpyrazol-1-yl)methyl]phenyl]methyl]pyrazol-3-yl]pyridine |
|---|
| Molecular Formula | C24H20N6 |
|---|---|
| Molecular Weight | 392.45600 |
| Exact Mass | 392.17500 |
| PSA | 61.42000 |
| LogP | 4.30020 |
| InChIKey | HQSNDROKUOFVMN-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccn(Cc3ccc(Cn4ccc(-c5ccccn5)n4)cc3)n2)nc1 |
|
~96%
2-[1-[[4-[(3-py... CAS#:306974-22-1 |
| Literature: Argent, Stephen P.; Adams, Harry; Riis-Johannessen, Thomas; Jeffery, John C.; Harding, Lindsay P.; Ward, Michael D. Journal of the American Chemical Society, 2006 , vol. 128, # 1 p. 72 - 73 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |