12-[(1-phenyl-1H-1,2,3,4-tetrazol-5-yl)sulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.0^{2,6}]dodeca-1(8),2(6),9,11-tetraene structure
|
Common Name | 12-[(1-phenyl-1H-1,2,3,4-tetrazol-5-yl)sulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.0^{2,6}]dodeca-1(8),2(6),9,11-tetraene | ||
|---|---|---|---|---|
| CAS Number | 307341-41-9 | Molecular Weight | 352.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 12-[(1-phenyl-1H-1,2,3,4-tetrazol-5-yl)sulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.0^{2,6}]dodeca-1(8),2(6),9,11-tetraene |
|---|
| Molecular Formula | C16H12N6S2 |
|---|---|
| Molecular Weight | 352.4 |
| InChIKey | PQAYZKKNKCLQBC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC3=C2C(=NC=N3)SC4=NN=NN4C5=CC=CC=C5 |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|