2-(2-imino-1,3-benzothiazol-3(2H)-yl)ethanethiol compound with 2,3-dihydro-45-[1,3]thiazolo[2,3-b][1,3]benzothiazole (1:1) structure
|
Common Name | 2-(2-imino-1,3-benzothiazol-3(2H)-yl)ethanethiol compound with 2,3-dihydro-45-[1,3]thiazolo[2,3-b][1,3]benzothiazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 30761-16-1 | Molecular Weight | 403.60800 | |
| Density | N/A | Boiling Point | 345.7ºC at 760 mmHg | |
| Molecular Formula | C18H17N3S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.9ºC | |
| Name | 1,2-dihydro-[1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium,2-(2-imino-1,3-benzothiazol-3-yl)ethanethiolate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 345.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H17N3S4 |
| Molecular Weight | 403.60800 |
| Flash Point | 162.9ºC |
| Exact Mass | 403.03100 |
| PSA | 114.44000 |
| LogP | 4.12340 |
| InChIKey | YCVLKYUQQAJNIU-UHFFFAOYSA-M |
| SMILES | N=c1sc2ccccc2n1CC[S-].c1ccc2c(c1)sc1[n+]2CCS1 |
|
~%
2-(2-imino-1,3-... CAS#:30761-16-1 |
| Literature: Sohar,P. et al. Journal of Heterocyclic Chemistry, 1970 , vol. 7, p. 1369 - 1376 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,3-dihydro-benzo[d]thiazolo[2,3-b]thiazolylium,2-(2-imino-benzothiazol-3-yl)-ethanethiolate |
| 1,2-dihydro-[1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium |
| 2-(2-imino-1,3-benzothiazol-3-yl)ethanethiolate |