(17R)-6,11,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one structure
|
Common Name | (17R)-6,11,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one | ||
|---|---|---|---|---|
| CAS Number | 3078-34-0 | Molecular Weight | 378.45900 | |
| Density | 1.35 g/cm3 | Boiling Point | 613ºC at 760 mmHg | |
| Molecular Formula | C21H30O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 338.6ºC | |
| Name | (17R)-6,11,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35 g/cm3 |
|---|---|
| Boiling Point | 613ºC at 760 mmHg |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.45900 |
| Flash Point | 338.6ºC |
| Exact Mass | 378.20400 |
| PSA | 115.06000 |
| LogP | 0.75240 |
| Index of Refraction | 1.611 |
| InChIKey | GNFTWPCIRXSCQF-HEEUUJINSA-N |
| SMILES | CC12CCC(=O)C=C1C(O)CC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| 6-Hydroxycortisol |
| 6beta-Hydroxycortisol |
| 4-Pregnene-6,11|A,17,21-tetrol-3,20-dione |
| 6|A-Hydroxycortisol |
| 4-Pregnene-6,11beta,17,21-tetrol-3,20-dione |