2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid structure
|
Common Name | 2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 3078-39-5 | Molecular Weight | 307.08500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10INO3 |
|---|---|
| Molecular Weight | 307.08500 |
| Exact Mass | 306.97100 |
| PSA | 83.55000 |
| LogP | 1.65150 |
| InChIKey | UQTZMGFTRHFAAM-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc(O)c(I)c1)C(=O)O |
| HS Code | 2922509090 |
|---|
|
~97%
2-amino-3-(4-hy... CAS#:3078-39-5 |
| Literature: Luca, Constantin; Zarna, Adriana; Anghel, Dan; Constantinescu, Titus Revue Roumaine de Chimie, 1996 , vol. 41, # 1-2 p. 125 - 130 |
|
~%
2-amino-3-(4-hy... CAS#:3078-39-5 |
| Literature: Harington; Pitt Rivers Biochemical Journal, 1944 , vol. 38, p. 320 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| meta-iodotyrosine |
| 3-iodo-DL-tyrosine |
| RAC-3-IODOTYROSINE |
| 3'-iodo-tyrosine |
| 5-iodotyrosine |