Phosphorothioic acid O,O-dimethyl O-[4-(butylsulfamoyl)phenyl] ester structure
|
Common Name | Phosphorothioic acid O,O-dimethyl O-[4-(butylsulfamoyl)phenyl] ester | ||
|---|---|---|---|---|
| CAS Number | 3078-85-1 | Molecular Weight | 353.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20NO5PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-butyl-4-dimethoxyphosphinothioyloxybenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20NO5PS2 |
|---|---|
| Molecular Weight | 353.39500 |
| Exact Mass | 353.05200 |
| PSA | 124.14000 |
| LogP | 4.78340 |
| InChIKey | HTQIEXVOHZYCJE-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)c1ccc(OP(=S)(OC)OC)cc1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Phosphorothioic acid,O,O-dimethyl ester,O-ester with N-butyl-p-hydroxybenzenesulfonamide |
| Benzenesulfonamide,N-butyl-p-hydroxy-,O-ester with O,O-dimethylphosphorothioate |