Phosphoric acid diethyl 4-(dimethylaminosulfonyl)phenyl ester structure
|
Common Name | Phosphoric acid diethyl 4-(dimethylaminosulfonyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 3079-03-6 | Molecular Weight | 337.32900 | |
| Density | 1.271g/cm3 | Boiling Point | 404.1ºC at 760 mmHg | |
| Molecular Formula | C12H20NO6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2ºC | |
| Name | [4-(dimethylsulfamoyl)phenyl] diethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 404.1ºC at 760 mmHg |
| Molecular Formula | C12H20NO6PS |
| Molecular Weight | 337.32900 |
| Flash Point | 198.2ºC |
| Exact Mass | 337.07500 |
| PSA | 100.33000 |
| LogP | 3.57760 |
| Index of Refraction | 1.508 |
| InChIKey | LWHKUUSAXOVOEU-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)Oc1ccc(S(=O)(=O)N(C)C)cc1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Phosphoric acid,diethyl ester,ester with N,N-dimethyl-p-hydroxybenzenesulfonamide |
| Benzenesulfonamide,N,N-dimethyl-p-hydroxy-,diethylphosphate |