1,4-Butanedisulfonyldichloride structure
|
Common Name | 1,4-Butanedisulfonyldichloride | ||
|---|---|---|---|---|
| CAS Number | 3079-82-1 | Molecular Weight | 255.14000 | |
| Density | 1.6 g/cm3 | Boiling Point | 361.9ºC at 760 mmHg | |
| Molecular Formula | C4H8Cl2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7ºC | |
| Name | butane-1,4-disulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6 g/cm3 |
|---|---|
| Boiling Point | 361.9ºC at 760 mmHg |
| Molecular Formula | C4H8Cl2O4S2 |
| Molecular Weight | 255.14000 |
| Flash Point | 172.7ºC |
| Exact Mass | 253.92400 |
| PSA | 85.04000 |
| LogP | 3.06540 |
| Index of Refraction | 1.512 |
| InChIKey | VZHRPLJULARYDO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)CCCCS(=O)(=O)Cl |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Butan-1,4-disulfonylchlorid |
| butane-1,4-disulfonyl dichloride |
| 1,4-BUTANEDISULFONYLCHLORIDE |
| 1,4-Butanedisulfonyl dichloride |