(2,4-diaminopyrimidin-5-yl)-(3,4,5-trimethoxyphenyl)methanone structure
|
Common Name | (2,4-diaminopyrimidin-5-yl)-(3,4,5-trimethoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 30806-86-1 | Molecular Weight | 304.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4-diaminopyrimidin-5-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N4O4 |
|---|---|
| Molecular Weight | 304.30100 |
| Exact Mass | 304.11700 |
| PSA | 124.04000 |
| LogP | 0.75800 |
| InChIKey | GAAPPIKAFNZRLA-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)c2cnc(N)nc2N)cc(OC)c1OC |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933599090 |
|
~72%
(2,4-diaminopyr... CAS#:30806-86-1 |
| Literature: Hess; Doelker; Haferburg; Kertscher; Matysik; Ortwein; Teubert; Zimmermann; Eger Pharmazie, 2001 , vol. 56, # 4 p. 306 - 310 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Diamino-5-<3,4,5-trimethoxy-benzoyl-pyrimidin |
| UNII-P56X2RU9WP |
| Carbonyltrimethoprim |
| Keto trimethoprim |
| RO-20-0570/002 |
| Trimethoprim related compound B |
| 2,4-Diamino-5-galloyl-pyrimidin |